mirror of
https://gitlab.com/freepascal.org/fpc/source.git
synced 2025-10-27 12:32:03 +01:00
790 lines
24 KiB
ObjectPascal
790 lines
24 KiB
ObjectPascal
{
|
|
$Id$
|
|
Copyright (c) 1998-2002 by Florian Klaempfl
|
|
|
|
This unit implements the first loading and searching of the modules
|
|
|
|
This program is free software; you can redistribute it and/or modify
|
|
it under the terms of the GNU General Public License as published by
|
|
the Free Software Foundation; either version 2 of the License, or
|
|
(at your option) any later version.
|
|
|
|
This program is distributed in the hope that it will be useful,
|
|
but WITHOUT ANY WARRANTY; without even the implied warranty of
|
|
MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
|
GNU General Public License for more details.
|
|
|
|
You should have received a copy of the GNU General Public License
|
|
along with this program; if not, write to the Free Software
|
|
Foundation, Inc., 675 Mass Ave, Cambridge, MA 02139, USA.
|
|
|
|
****************************************************************************
|
|
}
|
|
unit fmodule;
|
|
|
|
{$i fpcdefs.inc}
|
|
|
|
{$ifdef go32v2}
|
|
{$define shortasmprefix}
|
|
{$endif}
|
|
{$ifdef tos}
|
|
{$define shortasmprefix}
|
|
{$endif}
|
|
{$ifdef OS2}
|
|
{ Allthough OS/2 supports long filenames I play it safe and
|
|
use 8.3 filenames, because this allows the compiler to run
|
|
on a FAT partition. (DM) }
|
|
{$define shortasmprefix}
|
|
{$endif}
|
|
|
|
interface
|
|
|
|
uses
|
|
cutils,cclasses,
|
|
globals,finput,
|
|
symbase,symsym,aasmbase;
|
|
|
|
|
|
type
|
|
trecompile_reason = (rr_unknown,
|
|
rr_noppu,rr_sourcenewer,rr_build,rr_crcchanged
|
|
);
|
|
|
|
TExternalsItem=class(TLinkedListItem)
|
|
public
|
|
found : longbool;
|
|
data : pstring;
|
|
constructor Create(const s:string);
|
|
Destructor Destroy;override;
|
|
end;
|
|
|
|
tlinkcontaineritem=class(tlinkedlistitem)
|
|
public
|
|
data : pstring;
|
|
needlink : cardinal;
|
|
constructor Create(const s:string;m:cardinal);
|
|
destructor Destroy;override;
|
|
end;
|
|
|
|
tlinkcontainer=class(tlinkedlist)
|
|
procedure add(const s : string;m:cardinal);
|
|
function get(var m:cardinal) : string;
|
|
function getusemask(mask:cardinal) : string;
|
|
function find(const s:string):boolean;
|
|
end;
|
|
|
|
tmodule = class;
|
|
tused_unit = class;
|
|
|
|
tunitmaprec = record
|
|
u : tmodule;
|
|
unitsym : tunitsym;
|
|
end;
|
|
punitmap = ^tunitmaprec;
|
|
|
|
tmodule = class(tmodulebase)
|
|
do_reload, { force reloading of the unit }
|
|
do_compile, { need to compile the sources }
|
|
sources_avail, { if all sources are reachable }
|
|
interface_compiled, { if the interface section has been parsed/compiled/loaded }
|
|
is_unit,
|
|
in_interface, { processing the implementation part? }
|
|
in_global : boolean; { allow global settings }
|
|
recompile_reason : trecompile_reason; { the reason why the unit should be recompiled }
|
|
crc,
|
|
interface_crc : cardinal;
|
|
flags : cardinal; { the PPU flags }
|
|
islibrary : boolean; { if it is a library (win32 dll) }
|
|
map : punitmap; { mapping of all used units }
|
|
mapsize : longint; { number of units in the map }
|
|
derefdataintflen : longint;
|
|
derefdata : tdynamicarray;
|
|
globalsymtable, { pointer to the global symtable of this unit }
|
|
localsymtable : tsymtable;{ pointer to the local symtable of this unit }
|
|
scanner : pointer; { scanner object used }
|
|
procinfo : pointer; { current procedure being compiled }
|
|
loaded_from : tmodule;
|
|
uses_imports : boolean; { Set if the module imports from DLL's.}
|
|
imports : tlinkedlist;
|
|
_exports : tlinkedlist;
|
|
externals : tlinkedlist; {Only for DLL scanners by using Unix-style $LINKLIB }
|
|
resourcefiles : tstringlist;
|
|
linkunitofiles,
|
|
linkunitstaticlibs,
|
|
linkunitsharedlibs,
|
|
linkotherofiles, { objects,libs loaded from the source }
|
|
linkothersharedlibs, { using $L or $LINKLIB or import lib (for linux) }
|
|
linkotherstaticlibs : tlinkcontainer;
|
|
|
|
used_units : tlinkedlist;
|
|
dependent_units : tlinkedlist;
|
|
|
|
localunitsearchpath, { local searchpaths }
|
|
localobjectsearchpath,
|
|
localincludesearchpath,
|
|
locallibrarysearchpath : TSearchPathList;
|
|
|
|
asmprefix : pstring; { prefix for the smartlink asmfiles }
|
|
librarydata : tasmlibrarydata; { librarydata for this module }
|
|
{create creates a new module which name is stored in 's'. LoadedFrom
|
|
points to the module calling it. It is nil for the first compiled
|
|
module. This allow inheritence of all path lists. MUST pay attention
|
|
to that when creating link.res!!!!(mazen)}
|
|
constructor create(LoadedFrom:TModule;const s:string;_is_unit:boolean);
|
|
destructor destroy;override;
|
|
procedure reset;virtual;
|
|
procedure adddependency(callermodule:tmodule);
|
|
procedure flagdependent(callermodule:tmodule);
|
|
function addusedunit(hp:tmodule;inuses:boolean;usym:tunitsym):tused_unit;
|
|
procedure numberunits;
|
|
procedure allunitsused;
|
|
procedure setmodulename(const s:string);
|
|
end;
|
|
|
|
tused_unit = class(tlinkedlistitem)
|
|
unitid : longint;
|
|
checksum,
|
|
interface_checksum : cardinal;
|
|
in_uses,
|
|
in_interface,
|
|
is_stab_written : boolean;
|
|
u : tmodule;
|
|
unitsym : tunitsym;
|
|
constructor create(_u : tmodule;intface,inuses:boolean;usym:tunitsym);
|
|
end;
|
|
|
|
tdependent_unit = class(tlinkedlistitem)
|
|
u : tmodule;
|
|
constructor create(_u : tmodule);
|
|
end;
|
|
|
|
var
|
|
main_module : tmodule; { Main module of the program }
|
|
current_module : tmodule; { Current module which is compiled or loaded }
|
|
compiled_module : tmodule; { Current module which is compiled }
|
|
usedunits : tlinkedlist; { Used units for this program }
|
|
loaded_units : tlinkedlist; { All loaded units }
|
|
SmartLinkOFiles : TStringList; { List of .o files which are generated,
|
|
used to delete them after linking }
|
|
|
|
function get_source_file(moduleindex,fileindex : longint) : tinputfile;
|
|
|
|
|
|
implementation
|
|
|
|
uses
|
|
{$ifdef delphi}
|
|
dmisc,
|
|
{$else}
|
|
dos,
|
|
{$endif}
|
|
verbose,systems,
|
|
scanner,
|
|
procinfo;
|
|
|
|
|
|
{*****************************************************************************
|
|
Global Functions
|
|
*****************************************************************************}
|
|
|
|
function get_source_file(moduleindex,fileindex : longint) : tinputfile;
|
|
var
|
|
hp : tmodule;
|
|
begin
|
|
hp:=tmodule(loaded_units.first);
|
|
while assigned(hp) and (hp.unit_index<>moduleindex) do
|
|
hp:=tmodule(hp.next);
|
|
if assigned(hp) then
|
|
get_source_file:=hp.sourcefiles.get_file(fileindex)
|
|
else
|
|
get_source_file:=nil;
|
|
end;
|
|
|
|
|
|
{****************************************************************************
|
|
TLinkContainerItem
|
|
****************************************************************************}
|
|
|
|
constructor TLinkContainerItem.Create(const s:string;m:cardinal);
|
|
begin
|
|
inherited Create;
|
|
data:=stringdup(s);
|
|
needlink:=m;
|
|
end;
|
|
|
|
|
|
destructor TLinkContainerItem.Destroy;
|
|
begin
|
|
stringdispose(data);
|
|
end;
|
|
|
|
|
|
{****************************************************************************
|
|
TLinkContainer
|
|
****************************************************************************}
|
|
|
|
procedure TLinkContainer.add(const s : string;m:cardinal);
|
|
begin
|
|
inherited concat(TLinkContainerItem.Create(s,m));
|
|
end;
|
|
|
|
|
|
function TLinkContainer.get(var m:cardinal) : string;
|
|
var
|
|
p : tlinkcontaineritem;
|
|
begin
|
|
p:=tlinkcontaineritem(inherited getfirst);
|
|
if p=nil then
|
|
begin
|
|
get:='';
|
|
m:=0;
|
|
end
|
|
else
|
|
begin
|
|
get:=p.data^;
|
|
m:=p.needlink;
|
|
p.free;
|
|
end;
|
|
end;
|
|
|
|
|
|
function TLinkContainer.getusemask(mask:cardinal) : string;
|
|
var
|
|
p : tlinkcontaineritem;
|
|
found : boolean;
|
|
begin
|
|
found:=false;
|
|
repeat
|
|
p:=tlinkcontaineritem(inherited getfirst);
|
|
if p=nil then
|
|
begin
|
|
getusemask:='';
|
|
exit;
|
|
end;
|
|
getusemask:=p.data^;
|
|
found:=(p.needlink and mask)<>0;
|
|
p.free;
|
|
until found;
|
|
end;
|
|
|
|
|
|
function TLinkContainer.find(const s:string):boolean;
|
|
var
|
|
newnode : tlinkcontaineritem;
|
|
begin
|
|
find:=false;
|
|
newnode:=tlinkcontaineritem(First);
|
|
while assigned(newnode) do
|
|
begin
|
|
if newnode.data^=s then
|
|
begin
|
|
find:=true;
|
|
exit;
|
|
end;
|
|
newnode:=tlinkcontaineritem(newnode.next);
|
|
end;
|
|
end;
|
|
|
|
|
|
{****************************************************************************
|
|
TExternalsItem
|
|
****************************************************************************}
|
|
|
|
constructor tExternalsItem.Create(const s:string);
|
|
begin
|
|
inherited Create;
|
|
found:=false;
|
|
data:=stringdup(s);
|
|
end;
|
|
|
|
|
|
destructor tExternalsItem.Destroy;
|
|
begin
|
|
stringdispose(data);
|
|
inherited;
|
|
end;
|
|
|
|
|
|
{****************************************************************************
|
|
TUSED_UNIT
|
|
****************************************************************************}
|
|
|
|
constructor tused_unit.create(_u : tmodule;intface,inuses:boolean;usym:tunitsym);
|
|
begin
|
|
u:=_u;
|
|
in_interface:=intface;
|
|
in_uses:=inuses;
|
|
is_stab_written:=false;
|
|
unitid:=0;
|
|
unitsym:=usym;
|
|
if _u.state=ms_compiled then
|
|
begin
|
|
checksum:=u.crc;
|
|
interface_checksum:=u.interface_crc;
|
|
end
|
|
else
|
|
begin
|
|
checksum:=0;
|
|
interface_checksum:=0;
|
|
end;
|
|
end;
|
|
|
|
|
|
{****************************************************************************
|
|
TDENPENDENT_UNIT
|
|
****************************************************************************}
|
|
|
|
constructor tdependent_unit.create(_u : tmodule);
|
|
begin
|
|
u:=_u;
|
|
end;
|
|
|
|
|
|
{****************************************************************************
|
|
TMODULE
|
|
****************************************************************************}
|
|
|
|
constructor tmodule.create(LoadedFrom:TModule;const s:string;_is_unit:boolean);
|
|
var
|
|
p : dirstr;
|
|
n : namestr;
|
|
e : extstr;
|
|
begin
|
|
FSplit(s,p,n,e);
|
|
{ Programs have the name 'Program' to don't conflict with dup id's }
|
|
if _is_unit then
|
|
inherited create(n)
|
|
else
|
|
inherited create('Program');
|
|
mainsource:=stringdup(s);
|
|
{ Dos has the famous 8.3 limit :( }
|
|
{$ifdef shortasmprefix}
|
|
asmprefix:=stringdup(FixFileName('as'));
|
|
{$else}
|
|
asmprefix:=stringdup(FixFileName(n));
|
|
{$endif}
|
|
setfilename(p+n,true);
|
|
localunitsearchpath:=TSearchPathList.Create;
|
|
localobjectsearchpath:=TSearchPathList.Create;
|
|
localincludesearchpath:=TSearchPathList.Create;
|
|
locallibrarysearchpath:=TSearchPathList.Create;
|
|
used_units:=TLinkedList.Create;
|
|
dependent_units:=TLinkedList.Create;
|
|
resourcefiles:=TStringList.Create;
|
|
linkunitofiles:=TLinkContainer.Create;
|
|
linkunitstaticlibs:=TLinkContainer.Create;
|
|
linkunitsharedlibs:=TLinkContainer.Create;
|
|
linkotherofiles:=TLinkContainer.Create;
|
|
linkotherstaticlibs:=TLinkContainer.Create;
|
|
linkothersharedlibs:=TLinkContainer.Create;
|
|
crc:=0;
|
|
interface_crc:=0;
|
|
flags:=0;
|
|
scanner:=nil;
|
|
map:=nil;
|
|
mapsize:=0;
|
|
derefdata:=TDynamicArray.Create(1024);
|
|
derefdataintflen:=0;
|
|
globalsymtable:=nil;
|
|
localsymtable:=nil;
|
|
loaded_from:=LoadedFrom;
|
|
do_reload:=false;
|
|
do_compile:=false;
|
|
sources_avail:=true;
|
|
recompile_reason:=rr_unknown;
|
|
in_interface:=true;
|
|
in_global:=true;
|
|
is_unit:=_is_unit;
|
|
islibrary:=false;
|
|
uses_imports:=false;
|
|
imports:=TLinkedList.Create;
|
|
_exports:=TLinkedList.Create;
|
|
externals:=TLinkedList.Create;
|
|
librarydata:=tasmlibrarydata.create(realmodulename^);
|
|
end;
|
|
|
|
|
|
destructor tmodule.Destroy;
|
|
var
|
|
{$ifdef MEMDEBUG}
|
|
d : tmemdebug;
|
|
{$endif}
|
|
hpi : tprocinfo;
|
|
begin
|
|
dispose(map);
|
|
if assigned(imports) then
|
|
imports.free;
|
|
if assigned(_exports) then
|
|
_exports.free;
|
|
if assigned(externals) then
|
|
externals.free;
|
|
if assigned(scanner) then
|
|
begin
|
|
{ also update current_scanner if it was pointing
|
|
to this module }
|
|
if current_scanner=tscannerfile(scanner) then
|
|
current_scanner:=nil;
|
|
tscannerfile(scanner).free;
|
|
end;
|
|
if assigned(procinfo) then
|
|
begin
|
|
if current_procinfo=tprocinfo(procinfo) then
|
|
current_procinfo:=nil;
|
|
{ release procinfo tree }
|
|
while assigned(procinfo) do
|
|
begin
|
|
hpi:=tprocinfo(procinfo).parent;
|
|
tprocinfo(procinfo).free;
|
|
procinfo:=hpi;
|
|
end;
|
|
end;
|
|
used_units.free;
|
|
dependent_units.free;
|
|
resourcefiles.Free;
|
|
linkunitofiles.Free;
|
|
linkunitstaticlibs.Free;
|
|
linkunitsharedlibs.Free;
|
|
linkotherofiles.Free;
|
|
linkotherstaticlibs.Free;
|
|
linkothersharedlibs.Free;
|
|
stringdispose(objfilename);
|
|
stringdispose(newfilename);
|
|
stringdispose(ppufilename);
|
|
stringdispose(staticlibfilename);
|
|
stringdispose(sharedlibfilename);
|
|
stringdispose(exefilename);
|
|
stringdispose(outputpath);
|
|
stringdispose(path);
|
|
stringdispose(realmodulename);
|
|
stringdispose(mainsource);
|
|
stringdispose(asmprefix);
|
|
localunitsearchpath.Free;
|
|
localobjectsearchpath.free;
|
|
localincludesearchpath.free;
|
|
locallibrarysearchpath.free;
|
|
{$ifdef MEMDEBUG}
|
|
d:=tmemdebug.create(modulename^+' - symtable');
|
|
{$endif}
|
|
if assigned(globalsymtable) then
|
|
globalsymtable.free;
|
|
if assigned(localsymtable) then
|
|
localsymtable.free;
|
|
{$ifdef MEMDEBUG}
|
|
d.free;
|
|
{$endif}
|
|
{$ifdef MEMDEBUG}
|
|
d:=tmemdebug.create(modulename^+' - librarydata');
|
|
{$endif}
|
|
librarydata.free;
|
|
{$ifdef MEMDEBUG}
|
|
d.free;
|
|
{$endif}
|
|
stringdispose(modulename);
|
|
inherited Destroy;
|
|
end;
|
|
|
|
|
|
procedure tmodule.reset;
|
|
var
|
|
hpi : tprocinfo;
|
|
begin
|
|
if assigned(scanner) then
|
|
begin
|
|
{ also update current_scanner if it was pointing
|
|
to this module }
|
|
if current_scanner=tscannerfile(scanner) then
|
|
current_scanner:=nil;
|
|
tscannerfile(scanner).free;
|
|
scanner:=nil;
|
|
end;
|
|
if assigned(procinfo) then
|
|
begin
|
|
if current_procinfo=tprocinfo(procinfo) then
|
|
current_procinfo:=nil;
|
|
{ release procinfo tree }
|
|
while assigned(procinfo) do
|
|
begin
|
|
hpi:=tprocinfo(procinfo).parent;
|
|
tprocinfo(procinfo).free;
|
|
procinfo:=hpi;
|
|
end;
|
|
end;
|
|
if assigned(globalsymtable) then
|
|
begin
|
|
globalsymtable.free;
|
|
globalsymtable:=nil;
|
|
end;
|
|
if assigned(localsymtable) then
|
|
begin
|
|
localsymtable.free;
|
|
localsymtable:=nil;
|
|
end;
|
|
derefdata.free;
|
|
derefdata:=TDynamicArray.Create(1024);
|
|
if assigned(map) then
|
|
begin
|
|
freemem(map);
|
|
map:=nil;
|
|
end;
|
|
derefdataintflen:=0;
|
|
mapsize:=0;
|
|
sourcefiles.free;
|
|
sourcefiles:=tinputfilemanager.create;
|
|
librarydata.free;
|
|
librarydata:=tasmlibrarydata.create(realmodulename^);
|
|
imports.free;
|
|
imports:=tlinkedlist.create;
|
|
_exports.free;
|
|
_exports:=tlinkedlist.create;
|
|
externals.free;
|
|
externals:=tlinkedlist.create;
|
|
used_units.free;
|
|
used_units:=TLinkedList.Create;
|
|
dependent_units.free;
|
|
dependent_units:=TLinkedList.Create;
|
|
resourcefiles.Free;
|
|
resourcefiles:=TStringList.Create;
|
|
linkunitofiles.Free;
|
|
linkunitofiles:=TLinkContainer.Create;
|
|
linkunitstaticlibs.Free;
|
|
linkunitstaticlibs:=TLinkContainer.Create;
|
|
linkunitsharedlibs.Free;
|
|
linkunitsharedlibs:=TLinkContainer.Create;
|
|
linkotherofiles.Free;
|
|
linkotherofiles:=TLinkContainer.Create;
|
|
linkotherstaticlibs.Free;
|
|
linkotherstaticlibs:=TLinkContainer.Create;
|
|
linkothersharedlibs.Free;
|
|
linkothersharedlibs:=TLinkContainer.Create;
|
|
uses_imports:=false;
|
|
do_compile:=false;
|
|
interface_compiled:=false;
|
|
in_interface:=true;
|
|
in_global:=true;
|
|
crc:=0;
|
|
interface_crc:=0;
|
|
flags:=0;
|
|
recompile_reason:=rr_unknown;
|
|
{
|
|
The following fields should not
|
|
be reset:
|
|
mainsource
|
|
loaded_from
|
|
state
|
|
sources_avail
|
|
}
|
|
end;
|
|
|
|
|
|
procedure tmodule.adddependency(callermodule:tmodule);
|
|
begin
|
|
{ This is not needed for programs }
|
|
if not callermodule.is_unit then
|
|
exit;
|
|
Message2(unit_u_add_depend_to,callermodule.modulename^,modulename^);
|
|
dependent_units.concat(tdependent_unit.create(callermodule));
|
|
end;
|
|
|
|
|
|
procedure tmodule.flagdependent(callermodule:tmodule);
|
|
var
|
|
pm : tdependent_unit;
|
|
begin
|
|
{ flag all units that depend on this unit for reloading }
|
|
pm:=tdependent_unit(current_module.dependent_units.first);
|
|
while assigned(pm) do
|
|
begin
|
|
{ We do not have to reload the unit that wants to load
|
|
this unit, unless this unit is already compiled during
|
|
the loading }
|
|
if (pm.u=callermodule) and
|
|
(pm.u.state<>ms_compiled) then
|
|
Message1(unit_u_no_reload_is_caller,pm.u.modulename^)
|
|
else
|
|
if pm.u.state=ms_second_compile then
|
|
Message1(unit_u_no_reload_in_second_compile,pm.u.modulename^)
|
|
else
|
|
begin
|
|
pm.u.do_reload:=true;
|
|
Message1(unit_u_flag_for_reload,pm.u.modulename^);
|
|
end;
|
|
pm:=tdependent_unit(pm.next);
|
|
end;
|
|
end;
|
|
|
|
|
|
function tmodule.addusedunit(hp:tmodule;inuses:boolean;usym:tunitsym):tused_unit;
|
|
var
|
|
pu : tused_unit;
|
|
begin
|
|
pu:=tused_unit.create(hp,in_interface,inuses,usym);
|
|
used_units.concat(pu);
|
|
addusedunit:=pu;
|
|
end;
|
|
|
|
|
|
procedure tmodule.numberunits;
|
|
var
|
|
pu : tused_unit;
|
|
hp : tmodule;
|
|
i : integer;
|
|
begin
|
|
{ Reset all numbers to -1 }
|
|
hp:=tmodule(loaded_units.first);
|
|
while assigned(hp) do
|
|
begin
|
|
if assigned(hp.globalsymtable) then
|
|
hp.globalsymtable.unitid:=$ffff;
|
|
hp:=tmodule(hp.next);
|
|
end;
|
|
{ Allocate map }
|
|
mapsize:=used_units.count+1;
|
|
reallocmem(map,mapsize*sizeof(tunitmaprec));
|
|
{ Our own symtable gets unitid 0, for a program there is
|
|
no globalsymtable }
|
|
if assigned(globalsymtable) then
|
|
globalsymtable.unitid:=0;
|
|
map[0].u:=self;
|
|
map[0].unitsym:=nil;
|
|
{ number units and map }
|
|
i:=1;
|
|
pu:=tused_unit(used_units.first);
|
|
while assigned(pu) do
|
|
begin
|
|
if assigned(pu.u.globalsymtable) then
|
|
begin
|
|
tsymtable(pu.u.globalsymtable).unitid:=i;
|
|
map[i].u:=pu.u;
|
|
map[i].unitsym:=pu.unitsym;
|
|
inc(i);
|
|
end;
|
|
pu:=tused_unit(pu.next);
|
|
end;
|
|
end;
|
|
|
|
|
|
procedure tmodule.allunitsused;
|
|
var
|
|
i : longint;
|
|
begin
|
|
for i:=0 to mapsize-1 do
|
|
begin
|
|
if assigned(map[i].unitsym) and
|
|
(map[i].unitsym.refs=0) then
|
|
MessagePos2(map[i].unitsym.fileinfo,sym_n_unit_not_used,map[i].u.modulename^,modulename^);
|
|
end;
|
|
end;
|
|
|
|
|
|
procedure tmodule.setmodulename(const s:string);
|
|
begin
|
|
stringdispose(modulename);
|
|
stringdispose(realmodulename);
|
|
modulename:=stringdup(upper(s));
|
|
realmodulename:=stringdup(s);
|
|
{ also update asmlibrary names }
|
|
librarydata.name:=modulename^;
|
|
librarydata.realname:=realmodulename^;
|
|
end;
|
|
|
|
end.
|
|
{
|
|
$Log$
|
|
Revision 1.41 2003-10-23 14:44:07 peter
|
|
* splitted buildderef and buildderefimpl to fix interface crc
|
|
calculation
|
|
|
|
Revision 1.40 2003/10/22 20:40:00 peter
|
|
* write derefdata in a separate ppu entry
|
|
|
|
Revision 1.39 2003/10/22 15:22:33 peter
|
|
* fixed unitsym-globalsymtable relation so the uses of a unit
|
|
is counted correctly
|
|
|
|
Revision 1.38 2003/10/01 20:34:48 peter
|
|
* procinfo unit contains tprocinfo
|
|
* cginfo renamed to cgbase
|
|
* moved cgmessage to verbose
|
|
* fixed ppc and sparc compiles
|
|
|
|
Revision 1.37 2003/08/23 22:31:42 peter
|
|
* reload also caller module when it is already compiled
|
|
|
|
Revision 1.36 2003/06/07 20:26:32 peter
|
|
* re-resolving added instead of reloading from ppu
|
|
* tderef object added to store deref info for resolving
|
|
|
|
Revision 1.35 2003/05/25 10:27:12 peter
|
|
* moved Comment calls to messge file
|
|
|
|
Revision 1.34 2003/05/23 14:27:35 peter
|
|
* remove some unit dependencies
|
|
* current_procinfo changes to store more info
|
|
|
|
Revision 1.33 2003/04/27 11:21:32 peter
|
|
* aktprocdef renamed to current_procdef
|
|
* procinfo renamed to current_procinfo
|
|
* procinfo will now be stored in current_module so it can be
|
|
cleaned up properly
|
|
* gen_main_procsym changed to create_main_proc and release_main_proc
|
|
to also generate a tprocinfo structure
|
|
* fixed unit implicit initfinal
|
|
|
|
Revision 1.32 2002/12/29 14:57:50 peter
|
|
* unit loading changed to first register units and load them
|
|
afterwards. This is needed to support uses xxx in yyy correctly
|
|
* unit dependency check fixed
|
|
|
|
Revision 1.31 2002/12/07 14:27:07 carl
|
|
* 3% memory optimization
|
|
* changed some types
|
|
+ added type checking with different size for call node and for
|
|
parameters
|
|
|
|
Revision 1.30 2002/11/24 18:19:56 carl
|
|
+ tos also has short filenames
|
|
|
|
Revision 1.29 2002/11/20 12:36:23 mazen
|
|
* $UNITPATH directive is now working
|
|
|
|
Revision 1.28 2002/09/05 19:29:42 peter
|
|
* memdebug enhancements
|
|
|
|
Revision 1.27 2002/08/16 15:31:08 peter
|
|
* fixed possible crashes with current_scanner
|
|
|
|
Revision 1.26 2002/08/12 16:46:04 peter
|
|
* tscannerfile is now destroyed in tmodule.reset and current_scanner
|
|
is updated accordingly. This removes all the loading and saving of
|
|
the old scanner and the invalid flag marking
|
|
|
|
Revision 1.25 2002/08/11 14:28:19 peter
|
|
* TScannerFile.SetInvalid added that will also reset inputfile
|
|
|
|
Revision 1.24 2002/08/11 13:24:11 peter
|
|
* saving of asmsymbols in ppu supported
|
|
* asmsymbollist global is removed and moved into a new class
|
|
tasmlibrarydata that will hold the info of a .a file which
|
|
corresponds with a single module. Added librarydata to tmodule
|
|
to keep the library info stored for the module. In the future the
|
|
objectfiles will also be stored to the tasmlibrarydata class
|
|
* all getlabel/newasmsymbol and friends are moved to the new class
|
|
|
|
Revision 1.23 2002/05/16 19:46:36 carl
|
|
+ defines.inc -> fpcdefs.inc to avoid conflicts if compiling by hand
|
|
+ try to fix temp allocation (still in ifdef)
|
|
+ generic constructor calls
|
|
+ start of tassembler / tmodulebase class cleanup
|
|
|
|
Revision 1.22 2002/05/14 19:34:41 peter
|
|
* removed old logs and updated copyright year
|
|
|
|
Revision 1.21 2002/04/04 19:05:55 peter
|
|
* removed unused units
|
|
* use tlocation.size in cg.a_*loc*() routines
|
|
|
|
Revision 1.20 2002/03/28 20:46:59 carl
|
|
- remove go32v1 support
|
|
|
|
}
|